C27H45NO5Si — CID 11027394
methyl (4R,5S)-4-[benzyl(ethoxycarbonyl)amino]-2-methylidene-5-tri(propan-2-yl)silyloxyhexanoate (PubChem CID 11027394) has the molecular formula C27H45NO5Si and a molecular weight of 491.75 g/mol. Its IUPAC name is methyl (4R,5S)-4-[benzyl(ethoxycarbonyl)amino]-2-methylidene-5-tri(propan-2-yl)silyloxyhexanoate.
| Compound Name | methyl (4R,5S)-4-[benzyl(ethoxycarbonyl)amino]-2-methylidene-5-tri(propan-2-yl)silyloxyhexanoate |
|---|---|
| PubChem CID | 11027394 |
| Molecular Formula | C27H45NO5Si |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | methyl (4R,5S)-4-[benzyl(ethoxycarbonyl)amino]-2-methylidene-5-tri(propan-2-yl)silyloxyhexanoate |
| SMILES | C=C(C[C@H]([C@H](C)O[Si](C(C)C)(C(C)C)C(C)C)N(Cc1ccccc1)C(=O)OCC)C(=O)OC |
| InChI | InChI=1S/C27H45NO5Si/c1-11-32-27(30)28(18-24-15-13-12-14-16-24)25(17-22(8)26(29)31-10)23(9)33-34(19(2)3,20(4)5)21(6)7/h12-16,19-21,23,25H,8,11,17-18H2,1-7,9-10H3/t23-,25+/m0/s1 |
| InChIKey | KHEGLKOMGFPLFU-UKILVPOCSA-N |
| XLogP | 6.71 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|