C28H35NO4Si — CID 11059862
methyl (2S,4aR,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-oxo-2,3,4,4a,8,8a-hexahydroquinoline-1-carboxylate (PubChem CID 11059862) has the molecular formula C28H35NO4Si and a molecular weight of 477.68 g/mol. Its IUPAC name is methyl (2S,4aR,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-oxo-2,3,4,4a,8,8a-hexahydroquinoline-1-carboxylate.
| Compound Name | methyl (2S,4aR,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-oxo-2,3,4,4a,8,8a-hexahydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 11059862 |
| Molecular Formula | C28H35NO4Si |
| Molecular Weight | 477.68 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | methyl (2S,4aR,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-oxo-2,3,4,4a,8,8a-hexahydroquinoline-1-carboxylate |
| SMILES | COC(=O)N1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@@H]2C=CC(=O)C[C@@H]21 |
| InChI | InChI=1S/C28H35NO4Si/c1-28(2,3)34(24-11-7-5-8-12-24,25-13-9-6-10-14-25)33-20-22-17-15-21-16-18-23(30)19-26(21)29(22)27(31)32-4/h5-14,16,18,21-22,26H,15,17,19-20H2,1-4H3/t21-,22+,26+/m1/s1 |
| InChIKey | KPAZICVVQFRVGD-UFPGJGBJSA-N |
| XLogP | 4.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|