C27H43NO4Si — CID 139193373
tert-butyl (2R,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenacyl-2-prop-2-enylpiperidine-1-carboxylate (PubChem CID 139193373) has the molecular formula C27H43NO4Si and a molecular weight of 473.73 g/mol. Its IUPAC name is tert-butyl (2R,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenacyl-2-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenacyl-2-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139193373 |
| Molecular Formula | C27H43NO4Si |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | tert-butyl (2R,3R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-phenacyl-2-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)CC[C@H](CC(=O)c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H43NO4Si/c1-10-14-22-24(32-33(8,9)27(5,6)7)18-17-21(28(22)25(30)31-26(2,3)4)19-23(29)20-15-12-11-13-16-20/h10-13,15-16,21-22,24H,1,14,17-19H2,2-9H3/t21-,22-,24-/m1/s1 |
| InChIKey | XTOSAIWDETYLKC-CQOQZXRMSA-N |
| XLogP | 6.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|