C33H49NO4Si — CID 135010771
tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-9-oxo-1,9-diphenylnon-7-en-3-yl]-N-methylcarbamate (PubChem CID 135010771) has the molecular formula C33H49NO4Si and a molecular weight of 551.84 g/mol. Its IUPAC name is tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-9-oxo-1,9-diphenylnon-7-en-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-9-oxo-1,9-diphenylnon-7-en-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 135010771 |
| Molecular Formula | C33H49NO4Si |
| Molecular Weight | 551.84 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | tert-butyl N-[(1S,3R)-1-[tert-butyl(dimethyl)silyl]oxy-9-oxo-1,9-diphenylnon-7-en-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H](CCCC=CC(=O)c1ccccc1)C[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C33H49NO4Si/c1-32(2,3)37-31(36)34(7)28(23-17-12-18-24-29(35)26-19-13-10-14-20-26)25-30(27-21-15-11-16-22-27)38-39(8,9)33(4,5)6/h10-11,13-16,18-22,24,28,30H,12,17,23,25H2,1-9H3/t28-,30+/m1/s1 |
| InChIKey | HAESHEDIJCUGFR-DGPALRBDSA-N |
| XLogP | 8.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.84 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|