C29H39NO4Si — CID 10896309
methyl (2S,4aR,5S,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-7-oxo-2,3,4,4a,5,6,8,8a-octahydroquinoline-1-carboxylate (PubChem CID 10896309) has the molecular formula C29H39NO4Si and a molecular weight of 493.72 g/mol. Its IUPAC name is methyl (2S,4aR,5S,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-7-oxo-2,3,4,4a,5,6,8,8a-octahydroquinoline-1-carboxylate.
| Compound Name | methyl (2S,4aR,5S,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-7-oxo-2,3,4,4a,5,6,8,8a-octahydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 10896309 |
| Molecular Formula | C29H39NO4Si |
| Molecular Weight | 493.72 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | methyl (2S,4aR,5S,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyl-7-oxo-2,3,4,4a,5,6,8,8a-octahydroquinoline-1-carboxylate |
| SMILES | COC(=O)N1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@@H]2[C@@H](C)CC(=O)C[C@@H]21 |
| InChI | InChI=1S/C29H39NO4Si/c1-21-18-23(31)19-27-26(21)17-16-22(30(27)28(32)33-5)20-34-35(29(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-15,21-22,26-27H,16-20H2,1-5H3/t21-,22-,26+,27-/m0/s1 |
| InChIKey | FDKKSQQABCLWHP-ABMRFVCESA-N |
| XLogP | 4.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|