C33H40FNO4Si — CID 101157568
tert-butyl (2S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-6-oxopiperidine-1-carboxylate (PubChem CID 101157568) has the molecular formula C33H40FNO4Si and a molecular weight of 561.77 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-6-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-6-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 101157568 |
| Molecular Formula | C33H40FNO4Si |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.27 |
| IUPAC Name | tert-butyl (2S,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(4-fluorophenyl)-6-oxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C[C@H](c2ccc(F)cc2)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H40FNO4Si/c1-32(2,3)39-31(37)35-27(21-25(22-30(35)36)24-17-19-26(34)20-18-24)23-38-40(33(4,5)6,28-13-9-7-10-14-28)29-15-11-8-12-16-29/h7-20,25,27H,21-23H2,1-6H3/t25-,27+/m1/s1 |
| InChIKey | QMGIEKKNLPAFHG-VPUSJEBWSA-N |
| XLogP | 6.41 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|