C20H29NO3Si — CID 10383868
methyl (4aS,5R,8aR)-5-[[dimethyl(phenyl)silyl]methyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carboxylate (PubChem CID 10383868) has the molecular formula C20H29NO3Si and a molecular weight of 359.54 g/mol. Its IUPAC name is methyl (4aS,5R,8aR)-5-[[dimethyl(phenyl)silyl]methyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carboxylate.
| Compound Name | methyl (4aS,5R,8aR)-5-[[dimethyl(phenyl)silyl]methyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 10383868 |
| Molecular Formula | C20H29NO3Si |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | methyl (4aS,5R,8aR)-5-[[dimethyl(phenyl)silyl]methyl]-4-oxo-2,3,4a,5,6,7,8,8a-octahydroquinoline-1-carboxylate |
| SMILES | COC(=O)N1CCC(=O)[C@H]2[C@H](C[Si](C)(C)c3ccccc3)CCC[C@H]21 |
| InChI | InChI=1S/C20H29NO3Si/c1-24-20(23)21-13-12-18(22)19-15(8-7-11-17(19)21)14-25(2,3)16-9-5-4-6-10-16/h4-6,9-10,15,17,19H,7-8,11-14H2,1-3H3/t15-,17+,19-/m0/s1 |
| InChIKey | VCMJPEGXCPWWDO-WDYCEAGBSA-N |
| XLogP | 3.43 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|