C28H37NO5Si — CID 11027439
methyl (2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-formyl-2-(2-oxopropyl)piperidine-1-carboxylate (PubChem CID 11027439) has the molecular formula C28H37NO5Si and a molecular weight of 495.69 g/mol. Its IUPAC name is methyl (2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-formyl-2-(2-oxopropyl)piperidine-1-carboxylate.
| Compound Name | methyl (2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-formyl-2-(2-oxopropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11027439 |
| Molecular Formula | C28H37NO5Si |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | methyl (2S,3R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-formyl-2-(2-oxopropyl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@@H](C=O)[C@@H]1CC(C)=O |
| InChI | InChI=1S/C28H37NO5Si/c1-21(31)18-26-22(19-30)16-17-23(29(26)27(32)33-5)20-34-35(28(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-15,19,22-23,26H,16-18,20H2,1-5H3/t22-,23-,26-/m0/s1 |
| InChIKey | SJXXNBJDRHZYHV-FXSPECFOSA-N |
| XLogP | 3.96 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|