C31H41NO5Si — CID 10918522
tert-butyl (1R,3R,5S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(Z)-3-methoxy-3-oxoprop-1-enyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 10918522) has the molecular formula C31H41NO5Si and a molecular weight of 535.76 g/mol. Its IUPAC name is tert-butyl (1R,3R,5S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(Z)-3-methoxy-3-oxoprop-1-enyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (1R,3R,5S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(Z)-3-methoxy-3-oxoprop-1-enyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 10918522 |
| Molecular Formula | C31H41NO5Si |
| Molecular Weight | 535.76 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | tert-butyl (1R,3R,5S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-[(Z)-3-methoxy-3-oxoprop-1-enyl]-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | COC(=O)/C=C\[C@@]12C[C@@H]1C[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H41NO5Si/c1-29(2,3)37-28(34)32-24(20-23-21-31(23,32)19-18-27(33)35-7)22-36-38(30(4,5)6,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-19,23-24H,20-22H2,1-7H3/b19-18-/t23-,24+,31+/m0/s1 |
| InChIKey | AGLDHCNPXZSJLO-SMQXVWSWSA-N |
| XLogP | 5.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.76 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|