C34H43NO5Si — CID 25104817
tert-butyl (2S)-2-[(6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-2-oxo-6,7-dihydro-1-benzofuran-7a-yl]piperidine-1-carboxylate (PubChem CID 25104817) has the molecular formula C34H43NO5Si and a molecular weight of 573.81 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-2-oxo-6,7-dihydro-1-benzofuran-7a-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-2-oxo-6,7-dihydro-1-benzofuran-7a-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25104817 |
| Molecular Formula | C34H43NO5Si |
| Molecular Weight | 573.81 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | tert-butyl (2S)-2-[(6R,7aS)-6-[tert-butyl(diphenyl)silyl]oxy-2-oxo-6,7-dihydro-1-benzofuran-7a-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1[C@]12C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C=CC1=CC(=O)O2 |
| InChI | InChI=1S/C34H43NO5Si/c1-32(2,3)39-31(37)35-22-14-13-19-29(35)34-24-26(21-20-25(34)23-30(36)38-34)40-41(33(4,5)6,27-15-9-7-10-16-27)28-17-11-8-12-18-28/h7-12,15-18,20-21,23,26,29H,13-14,19,22,24H2,1-6H3/t26-,29-,34-/m0/s1 |
| InChIKey | BXEQVHAHRQSNGR-ASPXVNRKSA-N |
| XLogP | 5.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.81 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|