C35H51NO7Si — CID 160697386
tert-butyl (4S)-4-[(E,1R)-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate;propan-2-one (PubChem CID 160697386) has the molecular formula C35H51NO7Si and a molecular weight of 625.88 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(E,1R)-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate;propan-2-one.
| Compound Name | tert-butyl (4S)-4-[(E,1R)-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate;propan-2-one |
|---|---|
| PubChem CID | 160697386 |
| Molecular Formula | C35H51NO7Si |
| Molecular Weight | 625.88 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | tert-butyl (4S)-4-[(E,1R)-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate;propan-2-one |
| SMILES | CC(=O)O[C@H](/C=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C.CC(C)=O |
| InChI | InChI=1S/C32H45NO6Si.C3H6O/c1-24(34)38-28(27-23-36-32(8,9)33(27)29(35)39-30(2,3)4)21-16-22-37-40(31(5,6)7,25-17-12-10-13-18-25)26-19-14-11-15-20-26;1-3(2)4/h10-21,27-28H,22-23H2,1-9H3;1-2H3/b21-16+;/t27-,28+;/m0./s1 |
| InChIKey | RQEBNHUDYGIEAU-FYWUVSQDSA-N |
| XLogP | 6.02 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.88 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|