C35H49NO3Si — CID 101199429
(1R,3S,6S,8S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(cyclohexen-1-ylmethyl)-1-ethyl-8-methoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 101199429) has the molecular formula C35H49NO3Si and a molecular weight of 559.87 g/mol. Its IUPAC name is (1R,3S,6S,8S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(cyclohexen-1-ylmethyl)-1-ethyl-8-methoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1R,3S,6S,8S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(cyclohexen-1-ylmethyl)-1-ethyl-8-methoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 101199429 |
| Molecular Formula | C35H49NO3Si |
| Molecular Weight | 559.87 g/mol |
| Exact Mass | 559.35 |
| IUPAC Name | (1R,3S,6S,8S,8aS)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(cyclohexen-1-ylmethyl)-1-ethyl-8-methoxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N2C(=O)[C@@H](CC3=CCCCC3)C[C@H](OC)[C@H]12 |
| InChI | InChI=1S/C35H49NO3Si/c1-6-27-23-29(36-33(27)32(38-5)24-28(34(36)37)22-26-16-10-7-11-17-26)25-39-40(35(2,3)4,30-18-12-8-13-19-30)31-20-14-9-15-21-31/h8-9,12-16,18-21,27-29,32-33H,6-7,10-11,17,22-25H2,1-5H3/t27-,28+,29+,32+,33+/m1/s1 |
| InChIKey | PWXDGXZHVPLDNI-NWFBNIHCSA-N |
| XLogP | 6.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.87 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|