C25H32N4O2Si — CID 101012765
(5S,8aS)-2-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 101012765) has the molecular formula C25H32N4O2Si and a molecular weight of 448.64 g/mol. Its IUPAC name is (5S,8aS)-2-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (5S,8aS)-2-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 101012765 |
| Molecular Formula | C25H32N4O2Si |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (5S,8aS)-2-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCC[C@H]2CC(N=[N+]=[N-])C(=O)N12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32N4O2Si/c1-25(2,3)32(21-13-6-4-7-14-21,22-15-8-5-9-16-22)31-18-20-12-10-11-19-17-23(27-28-26)24(30)29(19)20/h4-9,13-16,19-20,23H,10-12,17-18H2,1-3H3/t19-,20-,23?/m0/s1 |
| InChIKey | INESHQWJTUUMBQ-ZXTYOHMPSA-N |
| XLogP | 4.40 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|