C25H30N4O2Si — CID 10928421
(1R,3R,5R,8S)-8-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azatricyclo[4.3.0.01,3]nonan-7-one (PubChem CID 10928421) has the molecular formula C25H30N4O2Si and a molecular weight of 446.63 g/mol. Its IUPAC name is (1R,3R,5R,8S)-8-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azatricyclo[4.3.0.01,3]nonan-7-one.
| Compound Name | (1R,3R,5R,8S)-8-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azatricyclo[4.3.0.01,3]nonan-7-one |
|---|---|
| PubChem CID | 10928421 |
| Molecular Formula | C25H30N4O2Si |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (1R,3R,5R,8S)-8-azido-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-azatricyclo[4.3.0.01,3]nonan-7-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@@H]2C[C@@]23C[C@H](N=[N+]=[N-])C(=O)N13)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30N4O2Si/c1-24(2,3)32(20-10-6-4-7-11-20,21-12-8-5-9-13-21)31-17-19-14-18-15-25(18)16-22(27-28-26)23(30)29(19)25/h4-13,18-19,22H,14-17H2,1-3H3/t18-,19-,22+,25-/m1/s1 |
| InChIKey | AJDJSXXQVFBXPU-YRQXSORESA-N |
| XLogP | 4.01 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|