C16H20N4O2 — CID 11087898
(3S,6R,8aS)-6-azido-6-benzyl-3-(hydroxymethyl)-1,2,3,7,8,8a-hexahydroindolizin-5-one (PubChem CID 11087898) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (3S,6R,8aS)-6-azido-6-benzyl-3-(hydroxymethyl)-1,2,3,7,8,8a-hexahydroindolizin-5-one.
| Compound Name | (3S,6R,8aS)-6-azido-6-benzyl-3-(hydroxymethyl)-1,2,3,7,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 11087898 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3S,6R,8aS)-6-azido-6-benzyl-3-(hydroxymethyl)-1,2,3,7,8,8a-hexahydroindolizin-5-one |
| SMILES | [N-]=[N+]=N[C@@]1(Cc2ccccc2)CC[C@@H]2CC[C@@H](CO)N2C1=O |
| InChI | InChI=1S/C16H20N4O2/c17-19-18-16(10-12-4-2-1-3-5-12)9-8-13-6-7-14(11-21)20(13)15(16)22/h1-5,13-14,21H,6-11H2/t13-,14-,16+/m0/s1 |
| InChIKey | SSCBZYDASRRHNB-OFQRWUPVSA-N |
| XLogP | 2.42 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|