C35H44N4O3Si — CID 101199433
(1R,3S,6S,8S,8aS)-6-azido-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethyl-8-methoxy-1,2,3,7,8,8a-hexahydroindolizin-5-one (PubChem CID 101199433) has the molecular formula C35H44N4O3Si and a molecular weight of 596.85 g/mol. Its IUPAC name is (1R,3S,6S,8S,8aS)-6-azido-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethyl-8-methoxy-1,2,3,7,8,8a-hexahydroindolizin-5-one.
| Compound Name | (1R,3S,6S,8S,8aS)-6-azido-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethyl-8-methoxy-1,2,3,7,8,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 101199433 |
| Molecular Formula | C35H44N4O3Si |
| Molecular Weight | 596.85 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | (1R,3S,6S,8S,8aS)-6-azido-6-benzyl-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-ethyl-8-methoxy-1,2,3,7,8,8a-hexahydroindolizin-5-one |
| SMILES | CC[C@@H]1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N2C(=O)[C@@](Cc3ccccc3)(N=[N+]=[N-])C[C@H](OC)[C@H]12 |
| InChI | InChI=1S/C35H44N4O3Si/c1-6-27-22-28(25-42-43(34(2,3)4,29-18-12-8-13-19-29)30-20-14-9-15-21-30)39-32(27)31(41-5)24-35(33(39)40,37-38-36)23-26-16-10-7-11-17-26/h7-21,27-28,31-32H,6,22-25H2,1-5H3/t27-,28+,31+,32+,35+/m1/s1 |
| InChIKey | PTZNUYKSOPCHAA-ADZOGVSDSA-N |
| XLogP | 6.27 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.85 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|