C25H33NO2Si — CID 102491473
(3S,8aS)-3-[[tert-butyl(diphenyl)silyl]methyl]-8-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 102491473) has the molecular formula C25H33NO2Si and a molecular weight of 407.63 g/mol. Its IUPAC name is (3S,8aS)-3-[[tert-butyl(diphenyl)silyl]methyl]-8-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (3S,8aS)-3-[[tert-butyl(diphenyl)silyl]methyl]-8-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 102491473 |
| Molecular Formula | C25H33NO2Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (3S,8aS)-3-[[tert-butyl(diphenyl)silyl]methyl]-8-hydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](C[C@@H]1CC[C@H]2C(O)CCC(=O)N12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H33NO2Si/c1-25(2,3)29(20-10-6-4-7-11-20,21-12-8-5-9-13-21)18-19-14-15-22-23(27)16-17-24(28)26(19)22/h4-13,19,22-23,27H,14-18H2,1-3H3/t19-,22-,23?/m0/s1 |
| InChIKey | MHYOBMZWKNLEME-ZKZAAWJASA-N |
| XLogP | 3.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|