C27H41NO4Si — CID 59100029
(3aR,7S,9R,9aS,9bS)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxyspiro[4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizine-2,1'-cyclohexane]-6-one (PubChem CID 59100029) has the molecular formula C27H41NO4Si and a molecular weight of 471.71 g/mol. Its IUPAC name is (3aR,7S,9R,9aS,9bS)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxyspiro[4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizine-2,1'-cyclohexane]-6-one.
| Compound Name | (3aR,7S,9R,9aS,9bS)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxyspiro[4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizine-2,1'-cyclohexane]-6-one |
|---|---|
| PubChem CID | 59100029 |
| Molecular Formula | C27H41NO4Si |
| Molecular Weight | 471.71 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | (3aR,7S,9R,9aS,9bS)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxyspiro[4,7,8,9,9a,9b-hexahydro-3aH-[1,3]dioxolo[4,5-a]indolizine-2,1'-cyclohexane]-6-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H](Cc2ccccc2)C(=O)N2C[C@H]3OC4(CCCCC4)O[C@H]3[C@@H]12 |
| InChI | InChI=1S/C27H41NO4Si/c1-26(2,3)33(4,5)32-21-17-20(16-19-12-8-6-9-13-19)25(29)28-18-22-24(23(21)28)31-27(30-22)14-10-7-11-15-27/h6,8-9,12-13,20-24H,7,10-11,14-18H2,1-5H3/t20-,21+,22+,23+,24+/m0/s1 |
| InChIKey | KOZGBPRZDCOPIQ-ODTAKUCXSA-N |
| XLogP | 5.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.71 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|