C34H41NO4 — CID 16681458
(3aR,6S,8R,8aS)-5-benzyl-8-phenylmethoxy-6-(phenylmethoxymethyl)spiro[3a,4,6,7,8,8a-hexahydro-[1,3]dioxolo[4,5-c]azepine-2,1'-cyclohexane] (PubChem CID 16681458) has the molecular formula C34H41NO4 and a molecular weight of 527.71 g/mol. Its IUPAC name is (3aR,6S,8R,8aS)-5-benzyl-8-phenylmethoxy-6-(phenylmethoxymethyl)spiro[3a,4,6,7,8,8a-hexahydro-[1,3]dioxolo[4,5-c]azepine-2,1'-cyclohexane].
| Compound Name | (3aR,6S,8R,8aS)-5-benzyl-8-phenylmethoxy-6-(phenylmethoxymethyl)spiro[3a,4,6,7,8,8a-hexahydro-[1,3]dioxolo[4,5-c]azepine-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 16681458 |
| Molecular Formula | C34H41NO4 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | (3aR,6S,8R,8aS)-5-benzyl-8-phenylmethoxy-6-(phenylmethoxymethyl)spiro[3a,4,6,7,8,8a-hexahydro-[1,3]dioxolo[4,5-c]azepine-2,1'-cyclohexane] |
| SMILES | c1ccc(COC[C@@H]2C[C@@H](OCc3ccccc3)[C@@H]3OC4(CCCCC4)O[C@@H]3CN2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H41NO4/c1-5-13-27(14-6-1)22-35-23-32-33(39-34(38-32)19-11-4-12-20-34)31(37-25-29-17-9-3-10-18-29)21-30(35)26-36-24-28-15-7-2-8-16-28/h1-3,5-10,13-18,30-33H,4,11-12,19-26H2/t30-,31+,32+,33-/m0/s1 |
| InChIKey | MCAJALDXKMWISO-FWGCVNADSA-N |
| XLogP | 6.51 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |