C34H38O5 — CID 10839860
(3aR,4S,5R,6Z,7aR)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethylidene)spiro[4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane] (PubChem CID 10839860) has the molecular formula C34H38O5 and a molecular weight of 526.67 g/mol. Its IUPAC name is (3aR,4S,5R,6Z,7aR)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethylidene)spiro[4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane].
| Compound Name | (3aR,4S,5R,6Z,7aR)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethylidene)spiro[4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 10839860 |
| Molecular Formula | C34H38O5 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | (3aR,4S,5R,6Z,7aR)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethylidene)spiro[4,5,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane] |
| SMILES | C(\OCc1ccccc1)=C1/C[C@H]2OC3(CCCCC3)O[C@H]2[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H38O5/c1-5-13-26(14-6-1)22-35-25-29-21-30-32(39-34(38-30)19-11-4-12-20-34)33(37-24-28-17-9-3-10-18-28)31(29)36-23-27-15-7-2-8-16-27/h1-3,5-10,13-18,25,30-33H,4,11-12,19-24H2/b29-25-/t30-,31-,32-,33+/m1/s1 |
| InChIKey | XWLGUSSJTCZIDN-BFSPPQADSA-N |
| XLogP | 7.11 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|