C27H36O6S — CID 102592216
(2S,3S,4aR,6S,9R,9aS)-2,3-dimethoxy-2,3-dimethyl-9-phenylmethoxy-6-(phenylmethoxymethyl)-4a,5,6,8,9,9a-hexahydrothiepino[4,5-b][1,4]dioxine (PubChem CID 102592216) has the molecular formula C27H36O6S and a molecular weight of 488.65 g/mol. Its IUPAC name is (2S,3S,4aR,6S,9R,9aS)-2,3-dimethoxy-2,3-dimethyl-9-phenylmethoxy-6-(phenylmethoxymethyl)-4a,5,6,8,9,9a-hexahydrothiepino[4,5-b][1,4]dioxine.
| Compound Name | (2S,3S,4aR,6S,9R,9aS)-2,3-dimethoxy-2,3-dimethyl-9-phenylmethoxy-6-(phenylmethoxymethyl)-4a,5,6,8,9,9a-hexahydrothiepino[4,5-b][1,4]dioxine |
|---|---|
| PubChem CID | 102592216 |
| Molecular Formula | C27H36O6S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | (2S,3S,4aR,6S,9R,9aS)-2,3-dimethoxy-2,3-dimethyl-9-phenylmethoxy-6-(phenylmethoxymethyl)-4a,5,6,8,9,9a-hexahydrothiepino[4,5-b][1,4]dioxine |
| SMILES | CO[C@@]1(C)O[C@@H]2[C@@H](OCc3ccccc3)CS[C@H](COCc3ccccc3)C[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C27H36O6S/c1-26(28-3)27(2,29-4)33-25-23(32-26)15-22(18-30-16-20-11-7-5-8-12-20)34-19-24(25)31-17-21-13-9-6-10-14-21/h5-14,22-25H,15-19H2,1-4H3/t22-,23+,24-,25-,26-,27-/m0/s1 |
| InChIKey | FTJNWKUABMOMSZ-OZCRVQINSA-N |
| XLogP | 4.80 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |