C20H28O9S — CID 58747925
(1S,2S,4R,5R,7R,8R,10S)-4,5-dimethoxy-4,5-dimethyl-8-phenylmethoxy-3,6,9,12-tetraoxa-13λ6-thiatricyclo[8.4.0.02,7]tetradecane 13,13-dioxide (PubChem CID 58747925) has the molecular formula C20H28O9S and a molecular weight of 444.50 g/mol. Its IUPAC name is (1S,2S,4R,5R,7R,8R,10S)-4,5-dimethoxy-4,5-dimethyl-8-phenylmethoxy-3,6,9,12-tetraoxa-13λ6-thiatricyclo[8.4.0.02,7]tetradecane 13,13-dioxide.
| Compound Name | (1S,2S,4R,5R,7R,8R,10S)-4,5-dimethoxy-4,5-dimethyl-8-phenylmethoxy-3,6,9,12-tetraoxa-13λ6-thiatricyclo[8.4.0.02,7]tetradecane 13,13-dioxide |
|---|---|
| PubChem CID | 58747925 |
| Molecular Formula | C20H28O9S |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (1S,2S,4R,5R,7R,8R,10S)-4,5-dimethoxy-4,5-dimethyl-8-phenylmethoxy-3,6,9,12-tetraoxa-13λ6-thiatricyclo[8.4.0.02,7]tetradecane 13,13-dioxide |
| SMILES | CO[C@]1(C)O[C@H]2[C@H](OCc3ccccc3)O[C@@H]3COS(=O)(=O)C[C@@H]3[C@@H]2O[C@@]1(C)OC |
| InChI | InChI=1S/C20H28O9S/c1-19(23-3)20(2,24-4)29-17-16(28-19)14-12-30(21,22)26-11-15(14)27-18(17)25-10-13-8-6-5-7-9-13/h5-9,14-18H,10-12H2,1-4H3/t14-,15+,16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | MBZQVUJQSUFTOF-BNLCHGIRSA-N |
| XLogP | 1.41 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|