C20H30O7 — CID 71500285
(2S,3S,4aR,5R,6S,8S,8aR)-8-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-6-phenylmethoxy-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]dioxin-5-ol (PubChem CID 71500285) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is (2S,3S,4aR,5R,6S,8S,8aR)-8-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-6-phenylmethoxy-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]dioxin-5-ol.
| Compound Name | (2S,3S,4aR,5R,6S,8S,8aR)-8-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-6-phenylmethoxy-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]dioxin-5-ol |
|---|---|
| PubChem CID | 71500285 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2S,3S,4aR,5R,6S,8S,8aR)-8-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-6-phenylmethoxy-4a,5,6,7,8,8a-hexahydrobenzo[b][1,4]dioxin-5-ol |
| SMILES | CO[C@@]1(C)O[C@@H]2[C@H](CO)C[C@H](OCc3ccccc3)[C@@H](O)[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C20H30O7/c1-19(23-3)20(2,24-4)27-18-16(22)15(10-14(11-21)17(18)26-19)25-12-13-8-6-5-7-9-13/h5-9,14-18,21-22H,10-12H2,1-4H3/t14-,15-,16+,17+,18+,19-,20-/m0/s1 |
| InChIKey | WVXZOLQMSSYWHZ-UQEPQNNOSA-N |
| XLogP | 1.45 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |