C31H41NO4Si — CID 177409965
1-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-[(Z)-prop-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]but-3-en-1-one (PubChem CID 177409965) has the molecular formula C31H41NO4Si and a molecular weight of 519.76 g/mol. Its IUPAC name is 1-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-[(Z)-prop-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]but-3-en-1-one.
| Compound Name | 1-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-[(Z)-prop-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 177409965 |
| Molecular Formula | C31H41NO4Si |
| Molecular Weight | 519.76 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | 1-[(3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4-[(Z)-prop-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-yl]but-3-en-1-one |
| SMILES | C=CCC(=O)N1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]2[C@@H]1/C=C\C |
| InChI | InChI=1S/C31H41NO4Si/c1-8-16-25-28-29(36-31(6,7)35-28)26(32(25)27(33)17-9-2)22-34-37(30(3,4)5,23-18-12-10-13-19-23)24-20-14-11-15-21-24/h8-16,18-21,25-26,28-29H,2,17,22H2,1,3-7H3/b16-8-/t25-,26+,28-,29+/m0/s1 |
| InChIKey | OFEZLRLGSLCYCW-RRZBXFDASA-N |
| XLogP | 4.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|