C32H44N2O5Si — CID 58676031
tert-butyl (3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(cyanomethyl)-2,2,3a-trimethyl-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 58676031) has the molecular formula C32H44N2O5Si and a molecular weight of 564.80 g/mol. Its IUPAC name is tert-butyl (3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(cyanomethyl)-2,2,3a-trimethyl-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(cyanomethyl)-2,2,3a-trimethyl-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 58676031 |
| Molecular Formula | C32H44N2O5Si |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.30 |
| IUPAC Name | tert-butyl (3aS,4S,6R,6aR)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(cyanomethyl)-2,2,3a-trimethyl-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@@]2(C)[C@@H]1CC#N |
| InChI | InChI=1S/C32H44N2O5Si/c1-29(2,3)38-28(35)34-25(27-32(9,26(34)20-21-33)39-31(7,8)37-27)22-36-40(30(4,5)6,23-16-12-10-13-17-23)24-18-14-11-15-19-24/h10-19,25-27H,20,22H2,1-9H3/t25-,26+,27-,32+/m1/s1 |
| InChIKey | AFXLPOUUXMTTBV-NIWNGRQCSA-N |
| XLogP | 5.37 |
| TPSA | 81.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|