C33H47NO6Si — CID 102190418
tert-butyl (3aR,4S,6S,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1R)-1-hydroxybut-3-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 102190418) has the molecular formula C33H47NO6Si and a molecular weight of 581.83 g/mol. Its IUPAC name is tert-butyl (3aR,4S,6S,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1R)-1-hydroxybut-3-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,4S,6S,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1R)-1-hydroxybut-3-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 102190418 |
| Molecular Formula | C33H47NO6Si |
| Molecular Weight | 581.83 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | tert-butyl (3aR,4S,6S,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1R)-1-hydroxybut-3-enyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | C=CC[C@@H](O)[C@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H47NO6Si/c1-10-17-26(35)27-29-28(38-33(8,9)39-29)25(34(27)30(36)40-31(2,3)4)22-37-41(32(5,6)7,23-18-13-11-14-19-23)24-20-15-12-16-21-24/h10-16,18-21,25-29,35H,1,17,22H2,2-9H3/t25-,26+,27-,28-,29+/m0/s1 |
| InChIKey | MMVOGRHYNWJRMA-UCWKTGAJSA-N |
| XLogP | 5.01 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|