C28H41NO5Si — CID 86634395
tert-butyl (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(2-hydroxyethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 86634395) has the molecular formula C28H41NO5Si and a molecular weight of 499.72 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(2-hydroxyethoxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(2-hydroxyethoxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86634395 |
| Molecular Formula | C28H41NO5Si |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | tert-butyl (2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-(2-hydroxyethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1COCCO |
| InChI | InChI=1S/C28H41NO5Si/c1-27(2,3)33-26(31)29-18-17-25(24(29)21-32-20-19-30)34-35(28(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,24-25,30H,17-21H2,1-6H3/t24-,25+/m1/s1 |
| InChIKey | KQTXPTZJUPVBPW-RPBOFIJWSA-N |
| XLogP | 3.95 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|