C30H45NO4Si — CID 178105872
tert-butyl (5S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-[(1R)-1-hydroxyethyl]pyrrolidine-1-carboxylate (PubChem CID 178105872) has the molecular formula C30H45NO4Si and a molecular weight of 511.78 g/mol. Its IUPAC name is tert-butyl (5S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-[(1R)-1-hydroxyethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-[(1R)-1-hydroxyethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178105872 |
| Molecular Formula | C30H45NO4Si |
| Molecular Weight | 511.78 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | tert-butyl (5S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-5-[(1R)-1-hydroxyethyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H](O)[C@@H]1CCC(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H45NO4Si/c1-23(32)27-21-20-24(31(27)28(33)35-29(2,3)4)15-14-22-34-36(30(5,6)7,25-16-10-8-11-17-25)26-18-12-9-13-19-26/h8-13,16-19,23-24,27,32H,14-15,20-22H2,1-7H3/t23-,24?,27+/m1/s1 |
| InChIKey | RVLVSLDZIPZRBW-WRNLUVMSSA-N |
| XLogP | 5.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.78 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|