C32H47NO3Si — CID 134956480
tert-butyl (2S)-2-[(3R,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-1-en-3-yl]pyrrolidine-1-carboxylate (PubChem CID 134956480) has the molecular formula C32H47NO3Si and a molecular weight of 521.82 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3R,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-1-en-3-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(3R,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-1-en-3-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134956480 |
| Molecular Formula | C32H47NO3Si |
| Molecular Weight | 521.82 g/mol |
| Exact Mass | 521.33 |
| IUPAC Name | tert-butyl (2S)-2-[(3R,4R)-6-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-1-en-3-yl]pyrrolidine-1-carboxylate |
| SMILES | C=C[C@H]([C@H](C)CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H47NO3Si/c1-9-28(29-21-16-23-33(29)30(34)36-31(3,4)5)25(2)22-24-35-37(32(6,7)8,26-17-12-10-13-18-26)27-19-14-11-15-20-27/h9-15,17-20,25,28-29H,1,16,21-24H2,2-8H3/t25-,28-,29+/m1/s1 |
| InChIKey | PLOMPCIGESJOQH-ZJGIAAPESA-N |
| XLogP | 6.79 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.82 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|