C31H55NO3Si — CID 10885794
tert-butyl (2S,3S,5R)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-5-nonylpyrrolidine-1-carboxylate (PubChem CID 10885794) has the molecular formula C31H55NO3Si and a molecular weight of 517.87 g/mol. Its IUPAC name is tert-butyl (2S,3S,5R)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-5-nonylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S,5R)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-5-nonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10885794 |
| Molecular Formula | C31H55NO3Si |
| Molecular Weight | 517.87 g/mol |
| Exact Mass | 517.40 |
| IUPAC Name | tert-butyl (2S,3S,5R)-2-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-5-nonylpyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCC[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H55NO3Si/c1-10-11-12-13-14-15-19-22-26-24-28(35-36(8,9)31(5,6)7)27(23-25-20-17-16-18-21-25)32(26)29(33)34-30(2,3)4/h16-18,20-21,26-28H,10-15,19,22-24H2,1-9H3/t26-,27+,28+/m1/s1 |
| InChIKey | BWPUAEBKOXEANJ-PKTNWEFCSA-N |
| XLogP | 9.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.87 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|