C33H48INO4Si — CID 11735069
tert-butyl (2S)-2-[(Z,2S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-4-iodo-6-methylhept-4-en-2-yl]pyrrolidine-1-carboxylate (PubChem CID 11735069) has the molecular formula C33H48INO4Si and a molecular weight of 677.74 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(Z,2S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-4-iodo-6-methylhept-4-en-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(Z,2S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-4-iodo-6-methylhept-4-en-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11735069 |
| Molecular Formula | C33H48INO4Si |
| Molecular Weight | 677.74 g/mol |
| Exact Mass | 677.24 |
| IUPAC Name | tert-butyl (2S)-2-[(Z,2S,6S)-7-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-4-iodo-6-methylhept-4-en-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C[C@@H](/C=C(\I)C[C@](C)(O)[C@@H]1CCCN1C(=O)OC(C)(C)C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H48INO4Si/c1-25(22-26(34)23-33(8,37)29-20-15-21-35(29)30(36)39-31(2,3)4)24-38-40(32(5,6)7,27-16-11-9-12-17-27)28-18-13-10-14-19-28/h9-14,16-19,22,25,29,37H,15,20-21,23-24H2,1-8H3/b26-22-/t25-,29-,33-/m0/s1 |
| InChIKey | UHILVNMSWKFQAT-UORZGMJESA-N |
| XLogP | 7.06 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.74 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|