C33H49NO6Si — CID 139040654
tert-butyl (2R,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-2-(methoxymethoxymethyl)-4-methyl-3-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 139040654) has the molecular formula C33H49NO6Si and a molecular weight of 583.84 g/mol. Its IUPAC name is tert-butyl (2R,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-2-(methoxymethoxymethyl)-4-methyl-3-prop-2-enylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-2-(methoxymethoxymethyl)-4-methyl-3-prop-2-enylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139040654 |
| Molecular Formula | C33H49NO6Si |
| Molecular Weight | 583.84 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | tert-butyl (2R,3R,4R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-hydroxy-2-(methoxymethoxymethyl)-4-methyl-3-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@@]1(O)[C@H](C)CN(C(=O)OC(C)(C)C)[C@]1(COCOC)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H49NO6Si/c1-10-21-33(36)26(2)22-34(29(35)40-30(3,4)5)32(33,23-38-25-37-9)24-39-41(31(6,7)8,27-17-13-11-14-18-27)28-19-15-12-16-20-28/h10-20,26,36H,1,21-25H2,2-9H3/t26-,32-,33-/m1/s1 |
| InChIKey | OZOZRKVPYDCNEG-AWHRAJPHSA-N |
| XLogP | 5.12 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.84 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|