C31H55NO7SeSi — CID 16748766
tert-butyl (2S,4R)-2-[3-hydroxy-1-(2-methoxyethoxymethoxy)-2-phenylselanylpropyl]-4-tri(propan-2-yl)silyloxypyrrolidine-1-carboxylate (PubChem CID 16748766) has the molecular formula C31H55NO7SeSi and a molecular weight of 660.83 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[3-hydroxy-1-(2-methoxyethoxymethoxy)-2-phenylselanylpropyl]-4-tri(propan-2-yl)silyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[3-hydroxy-1-(2-methoxyethoxymethoxy)-2-phenylselanylpropyl]-4-tri(propan-2-yl)silyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 16748766 |
| Molecular Formula | C31H55NO7SeSi |
| Molecular Weight | 660.83 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | tert-butyl (2S,4R)-2-[3-hydroxy-1-(2-methoxyethoxymethoxy)-2-phenylselanylpropyl]-4-tri(propan-2-yl)silyloxypyrrolidine-1-carboxylate |
| SMILES | COCCOCOC(C(CO)[Se]c1ccccc1)[C@@H]1C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H55NO7SeSi/c1-22(2)41(23(3)4,24(5)6)39-25-18-27(32(19-25)30(34)38-31(7,8)9)29(37-21-36-17-16-35-10)28(20-33)40-26-14-12-11-13-15-26/h11-15,22-25,27-29,33H,16-21H2,1-10H3/t25-,27+,28?,29?/m1/s1 |
| InChIKey | NZXWEFCXIOOVLM-HSVMHTRTSA-N |
| XLogP | 5.37 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.83 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|