C24H37NO8Se — CID 16748767
tert-butyl (2S,4R)-2-[3-acetyloxy-1-(2-methoxyethoxymethoxy)-2-phenylselanylpropyl]-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 16748767) has the molecular formula C24H37NO8Se and a molecular weight of 546.52 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[3-acetyloxy-1-(2-methoxyethoxymethoxy)-2-phenylselanylpropyl]-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[3-acetyloxy-1-(2-methoxyethoxymethoxy)-2-phenylselanylpropyl]-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 16748767 |
| Molecular Formula | C24H37NO8Se |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | tert-butyl (2S,4R)-2-[3-acetyloxy-1-(2-methoxyethoxymethoxy)-2-phenylselanylpropyl]-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | COCCOCOC(C(COC(C)=O)[Se]c1ccccc1)[C@@H]1C[C@@H](O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H37NO8Se/c1-17(26)31-15-21(34-19-9-7-6-8-10-19)22(32-16-30-12-11-29-5)20-13-18(27)14-25(20)23(28)33-24(2,3)4/h6-10,18,20-22,27H,11-16H2,1-5H3/t18-,20+,21?,22?/m1/s1 |
| InChIKey | JAZGSGURRUSDQV-UREXAPBRSA-N |
| XLogP | 1.74 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|