C37H48N2O6Si — CID 100985090
tert-butyl (2R,4R)-2-[(E,1S)-1-[benzyl(hydroxy)amino]-4-methoxy-4-oxobut-2-enyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 100985090) has the molecular formula C37H48N2O6Si and a molecular weight of 644.89 g/mol. Its IUPAC name is tert-butyl (2R,4R)-2-[(E,1S)-1-[benzyl(hydroxy)amino]-4-methoxy-4-oxobut-2-enyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R)-2-[(E,1S)-1-[benzyl(hydroxy)amino]-4-methoxy-4-oxobut-2-enyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100985090 |
| Molecular Formula | C37H48N2O6Si |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.33 |
| IUPAC Name | tert-butyl (2R,4R)-2-[(E,1S)-1-[benzyl(hydroxy)amino]-4-methoxy-4-oxobut-2-enyl]-4-[tert-butyl(diphenyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | COC(=O)/C=C/[C@@H]([C@H]1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CN1C(=O)OC(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C37H48N2O6Si/c1-36(2,3)44-35(41)38-27-29(25-33(38)32(23-24-34(40)43-7)39(42)26-28-17-11-8-12-18-28)45-46(37(4,5)6,30-19-13-9-14-20-30)31-21-15-10-16-22-31/h8-24,29,32-33,42H,25-27H2,1-7H3/b24-23+/t29-,32+,33-/m1/s1 |
| InChIKey | QRBRVOVCENNDJX-MUBUBJJESA-N |
| XLogP | 5.93 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|