C28H37NO5Si — CID 101105791
N-[(1R)-1-[(3aR,5R,6S,6aR)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]acetamide (PubChem CID 101105791) has the molecular formula C28H37NO5Si and a molecular weight of 495.69 g/mol. Its IUPAC name is N-[(1R)-1-[(3aR,5R,6S,6aR)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]acetamide.
| Compound Name | N-[(1R)-1-[(3aR,5R,6S,6aR)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 101105791 |
| Molecular Formula | C28H37NO5Si |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | N-[(1R)-1-[(3aR,5R,6S,6aR)-6-[tert-butyl(diphenyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]prop-2-enyl]acetamide |
| SMILES | C=C[C@@H](NC(C)=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO5Si/c1-8-22(29-19(2)30)23-24(25-26(31-23)33-28(6,7)32-25)34-35(27(3,4)5,20-15-11-9-12-16-20)21-17-13-10-14-18-21/h8-18,22-26H,1H2,2-7H3,(H,29,30)/t22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | FIUYXRAIUASAKX-WSGIOKLISA-N |
| XLogP | 3.50 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|