C31H43NO3Si — CID 102150868
[(3aS,4S,6R,6aR)-5-but-3-enyl-2,2-dimethyl-4-[(E)-prop-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 102150868) has the molecular formula C31H43NO3Si and a molecular weight of 505.78 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-5-but-3-enyl-2,2-dimethyl-4-[(E)-prop-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3aS,4S,6R,6aR)-5-but-3-enyl-2,2-dimethyl-4-[(E)-prop-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 102150868 |
| Molecular Formula | C31H43NO3Si |
| Molecular Weight | 505.78 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | [(3aS,4S,6R,6aR)-5-but-3-enyl-2,2-dimethyl-4-[(E)-prop-1-enyl]-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | C=CCCN1[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]2[C@@H]1/C=C/C |
| InChI | InChI=1S/C31H43NO3Si/c1-8-10-22-32-26(17-9-2)28-29(35-31(6,7)34-28)27(32)23-33-36(30(3,4)5,24-18-13-11-14-19-24)25-20-15-12-16-21-25/h8-9,11-21,26-29H,1,10,22-23H2,2-7H3/b17-9+/t26-,27+,28-,29+/m0/s1 |
| InChIKey | XIGIXVCZEAOBKX-IZSQZGBDSA-N |
| XLogP | 5.29 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.78 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|