C30H43NO3Si — CID 10767486
[(1S)-1-[(3aS,4S,6aR)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]but-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 10767486) has the molecular formula C30H43NO3Si and a molecular weight of 493.76 g/mol. Its IUPAC name is [(1S)-1-[(3aS,4S,6aR)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]but-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-1-[(3aS,4S,6aR)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]but-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10767486 |
| Molecular Formula | C30H43NO3Si |
| Molecular Weight | 493.76 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | [(1S)-1-[(3aS,4S,6aR)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]but-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1[C@@H]2OC(C)(C)O[C@@H]2CN1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H43NO3Si/c1-9-16-24(34-35(7,8)29(2,3)4)27-28-25(32-30(5,6)33-28)21-31(27)26(22-17-12-10-13-18-22)23-19-14-11-15-20-23/h9-15,17-20,24-28H,1,16,21H2,2-8H3/t24-,25+,27+,28+/m0/s1 |
| InChIKey | ZEXAVEDFYVBGFR-PAVXMLEDSA-N |
| XLogP | 6.95 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.76 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|