C24H34N2O2+2 — CID 101434309
[(3S,3aR,6S,6aR)-6-[benzyl(dimethyl)azaniumyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-benzyl-dimethylazanium (PubChem CID 101434309) has the molecular formula C24H34N2O2+2 and a molecular weight of 382.55 g/mol. Its IUPAC name is [(3S,3aR,6S,6aR)-6-[benzyl(dimethyl)azaniumyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-benzyl-dimethylazanium.
| Compound Name | [(3S,3aR,6S,6aR)-6-[benzyl(dimethyl)azaniumyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-benzyl-dimethylazanium |
|---|---|
| PubChem CID | 101434309 |
| Molecular Formula | C24H34N2O2+2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | [(3S,3aR,6S,6aR)-6-[benzyl(dimethyl)azaniumyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-benzyl-dimethylazanium |
| SMILES | C[N+](C)(Cc1ccccc1)[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H34N2O2/c1-25(2,15-19-11-7-5-8-12-19)21-17-27-24-22(18-28-23(21)24)26(3,4)16-20-13-9-6-10-14-20/h5-14,21-24H,15-18H2,1-4H3/q+2/t21-,22-,23+,24+/m0/s1 |
| InChIKey | JAHLRHCCQCRCOP-CJRSTVEYSA-N |
| XLogP | 3.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|