C24H29NO3 — CID 11111672
(2S,3S)-2-[(1S)-1-(dibenzylamino)ethyl]-3-(1-methoxypropa-1,2-dienyl)oxolan-3-ol (PubChem CID 11111672) has the molecular formula C24H29NO3 and a molecular weight of 379.50 g/mol. Its IUPAC name is (2S,3S)-2-[(1S)-1-(dibenzylamino)ethyl]-3-(1-methoxypropa-1,2-dienyl)oxolan-3-ol.
| Compound Name | (2S,3S)-2-[(1S)-1-(dibenzylamino)ethyl]-3-(1-methoxypropa-1,2-dienyl)oxolan-3-ol |
|---|---|
| PubChem CID | 11111672 |
| Molecular Formula | C24H29NO3 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | (2S,3S)-2-[(1S)-1-(dibenzylamino)ethyl]-3-(1-methoxypropa-1,2-dienyl)oxolan-3-ol |
| SMILES | C=C=C(OC)[C@]1(O)CCO[C@H]1[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29NO3/c1-4-22(27-3)24(26)15-16-28-23(24)19(2)25(17-20-11-7-5-8-12-20)18-21-13-9-6-10-14-21/h5-14,19,23,26H,1,15-18H2,2-3H3/t19-,23-,24+/m0/s1 |
| InChIKey | LRBYLSGOZXBNCK-WDJPJFJCSA-N |
| XLogP | 3.91 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|