C19H23NO3 — CID 134931479
(2S,3R,4R)-2-[(dibenzylamino)methyl]oxolane-3,4-diol (PubChem CID 134931479) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2S,3R,4R)-2-[(dibenzylamino)methyl]oxolane-3,4-diol.
| Compound Name | (2S,3R,4R)-2-[(dibenzylamino)methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 134931479 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2S,3R,4R)-2-[(dibenzylamino)methyl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)CO[C@H]1CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23NO3/c21-17-14-23-18(19(17)22)13-20(11-15-7-3-1-4-8-15)12-16-9-5-2-6-10-16/h1-10,17-19,21-22H,11-14H2/t17-,18+,19-/m1/s1 |
| InChIKey | MDNXERNLPABCJA-CEXWTWQISA-N |
| XLogP | 1.81 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |