C23H29NO2 — CID 134932906
(4S,5S)-5-(dibenzylamino)-3-methoxy-6-methylhepta-1,2-dien-4-ol (PubChem CID 134932906) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (4S,5S)-5-(dibenzylamino)-3-methoxy-6-methylhepta-1,2-dien-4-ol.
| Compound Name | (4S,5S)-5-(dibenzylamino)-3-methoxy-6-methylhepta-1,2-dien-4-ol |
|---|---|
| PubChem CID | 134932906 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (4S,5S)-5-(dibenzylamino)-3-methoxy-6-methylhepta-1,2-dien-4-ol |
| SMILES | C=C=C(OC)[C@@H](O)[C@H](C(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H29NO2/c1-5-21(26-4)23(25)22(18(2)3)24(16-19-12-8-6-9-13-19)17-20-14-10-7-11-15-20/h6-15,18,22-23,25H,1,16-17H2,2-4H3/t22-,23+/m0/s1 |
| InChIKey | XQABYXJNQCPHPL-XZOQPEGZSA-N |
| XLogP | 4.39 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|