C27H39NO3Si — CID 10837400
[(3aS,4R,6aR)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 10837400) has the molecular formula C27H39NO3Si and a molecular weight of 453.70 g/mol. Its IUPAC name is [(3aS,4R,6aR)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4R,6aR)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10837400 |
| Molecular Formula | C27H39NO3Si |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | [(3aS,4R,6aR)-5-benzhydryl-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)N(C(c3ccccc3)c3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C27H39NO3Si/c1-26(2,3)32(6,7)29-19-22-25-23(30-27(4,5)31-25)18-28(22)24(20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-17,22-25H,18-19H2,1-7H3/t22-,23-,25+/m1/s1 |
| InChIKey | CDQIGWZQXNMTNV-OYRHQHFDSA-N |
| XLogP | 6.00 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|