C30H41NO5Si — CID 176735012
N-[(3aR,4R,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide (PubChem CID 176735012) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is N-[(3aR,4R,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide.
| Compound Name | N-[(3aR,4R,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide |
|---|---|
| PubChem CID | 176735012 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | N-[(3aR,4R,7R,7aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-6-prop-2-enyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]acetamide |
| SMILES | C=CCC1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1NC(C)=O |
| InChI | InChI=1S/C30H41NO5Si/c1-8-15-24-26(31-21(2)32)28-27(35-30(6,7)36-28)25(34-24)20-33-37(29(3,4)5,22-16-11-9-12-17-22)23-18-13-10-14-19-23/h8-14,16-19,24-28H,1,15,20H2,2-7H3,(H,31,32)/t24?,25-,26-,27+,28-/m1/s1 |
| InChIKey | UABPROZUPYFWLG-DPFFOKIGSA-N |
| XLogP | 3.93 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|