C25H33N3O5Si — CID 176778007
(3aS,6R,7aR)-6-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 176778007) has the molecular formula C25H33N3O5Si and a molecular weight of 483.64 g/mol. Its IUPAC name is (3aS,6R,7aR)-6-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aS,6R,7aR)-6-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 176778007 |
| Molecular Formula | C25H33N3O5Si |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (3aS,6R,7aR)-6-azido-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | CC1(C)O[C@@H]2C(O)[C@H](N=[N+]=[N-])OC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C25H33N3O5Si/c1-24(2,3)34(17-12-8-6-9-13-17,18-14-10-7-11-15-18)30-16-19-21-22(33-25(4,5)32-21)20(29)23(31-19)27-28-26/h6-15,19-23,29H,16H2,1-5H3/t19?,20?,21-,22+,23+/m0/s1 |
| InChIKey | RSUNOAVDHPDBNG-JTPDYBDNSA-N |
| XLogP | 3.48 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|