C25H37NO4Si — CID 57386214
1-amino-3-[(4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol (PubChem CID 57386214) has the molecular formula C25H37NO4Si and a molecular weight of 443.66 g/mol. Its IUPAC name is 1-amino-3-[(4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol.
| Compound Name | 1-amino-3-[(4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 57386214 |
| Molecular Formula | C25H37NO4Si |
| Molecular Weight | 443.66 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 1-amino-3-[(4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propan-2-ol |
| SMILES | CC1(C)O[C@@H](CC(O)CN)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C25H37NO4Si/c1-24(2,3)31(20-12-8-6-9-13-20,21-14-10-7-11-15-21)28-18-23-22(16-19(27)17-26)29-25(4,5)30-23/h6-15,19,22-23,27H,16-18,26H2,1-5H3/t19?,22-,23+/m0/s1 |
| InChIKey | YKTYZFPVUHWVAI-NWZLQDFTSA-N |
| XLogP | 2.79 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.66 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|