C22H31NO3Si — CID 67707376
(2R,3S,5S)-5-(aminomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol (PubChem CID 67707376) has the molecular formula C22H31NO3Si and a molecular weight of 385.58 g/mol. Its IUPAC name is (2R,3S,5S)-5-(aminomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol.
| Compound Name | (2R,3S,5S)-5-(aminomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 67707376 |
| Molecular Formula | C22H31NO3Si |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (2R,3S,5S)-5-(aminomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](CN)C[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31NO3Si/c1-22(2,3)27(18-10-6-4-7-11-18,19-12-8-5-9-13-19)25-16-21-20(24)14-17(15-23)26-21/h4-13,17,20-21,24H,14-16,23H2,1-3H3/t17-,20-,21+/m0/s1 |
| InChIKey | CVROWVTVTXXBBK-DZFGPLHGSA-N |
| XLogP | 2.04 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|