C22H29N3O3Si — CID 86750351
(2R,3R,5S)-5-(azidomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol (PubChem CID 86750351) has the molecular formula C22H29N3O3Si and a molecular weight of 411.58 g/mol. Its IUPAC name is (2R,3R,5S)-5-(azidomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol.
| Compound Name | (2R,3R,5S)-5-(azidomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 86750351 |
| Molecular Formula | C22H29N3O3Si |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (2R,3R,5S)-5-(azidomethyl)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-3-ol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@H](CN=[N+]=[N-])C[C@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O3Si/c1-22(2,3)29(18-10-6-4-7-11-18,19-12-8-5-9-13-19)27-16-21-20(26)14-17(28-21)15-24-25-23/h4-13,17,20-21,26H,14-16H2,1-3H3/t17-,20+,21+/m0/s1 |
| InChIKey | XPXMCUXHJIDMAJ-IOMROCGXSA-N |
| XLogP | 3.39 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|