C22H30O3Si — CID 58521398
(2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxolan-3-ol (PubChem CID 58521398) has the molecular formula C22H30O3Si and a molecular weight of 370.56 g/mol. Its IUPAC name is (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxolan-3-ol.
| Compound Name | (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxolan-3-ol |
|---|---|
| PubChem CID | 58521398 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-methyloxolan-3-ol |
| SMILES | CC1C[C@H](O)[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H30O3Si/c1-17-15-20(23)21(25-17)16-24-26(22(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,17,20-21,23H,15-16H2,1-4H3/t17?,20-,21-/m0/s1 |
| InChIKey | SNHOOALXOXLWMH-FUKGKQRISA-N |
| XLogP | 3.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|