C21H29N3O3Si — CID 11795235
(2R,3S)-5-azido-3-[tert-butyl(diphenyl)silyl]oxypentane-1,2-diol (PubChem CID 11795235) has the molecular formula C21H29N3O3Si and a molecular weight of 399.57 g/mol. Its IUPAC name is (2R,3S)-5-azido-3-[tert-butyl(diphenyl)silyl]oxypentane-1,2-diol.
| Compound Name | (2R,3S)-5-azido-3-[tert-butyl(diphenyl)silyl]oxypentane-1,2-diol |
|---|---|
| PubChem CID | 11795235 |
| Molecular Formula | C21H29N3O3Si |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (2R,3S)-5-azido-3-[tert-butyl(diphenyl)silyl]oxypentane-1,2-diol |
| SMILES | CC(C)(C)[Si](O[C@@H](CCN=[N+]=[N-])[C@H](O)CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29N3O3Si/c1-21(2,3)28(17-10-6-4-7-11-17,18-12-8-5-9-13-18)27-20(19(26)16-25)14-15-23-24-22/h4-13,19-20,25-26H,14-16H2,1-3H3/t19-,20+/m1/s1 |
| InChIKey | ZQAYZEKVZBGFJT-UXHICEINSA-N |
| XLogP | 2.99 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|